C16H20O2 — CID 6932682
(1R,9R)-4,4,10-trimethyltricyclo[7.3.1.01,6]trideca-6,10-diene-2,8-dione (PubChem CID 6932682) has the molecular formula C16H20O2 and a molecular weight of 244.33 g/mol. Its IUPAC name is (1R,9R)-4,4,10-trimethyltricyclo[7.3.1.01,6]trideca-6,10-diene-2,8-dione.
| Compound Name | (1R,9R)-4,4,10-trimethyltricyclo[7.3.1.01,6]trideca-6,10-diene-2,8-dione |
|---|---|
| PubChem CID | 6932682 |
| Molecular Formula | C16H20O2 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.15 |
| IUPAC Name | (1R,9R)-4,4,10-trimethyltricyclo[7.3.1.01,6]trideca-6,10-diene-2,8-dione |
| SMILES | CC1=CC[C@@]23C[C@H]1C(=O)C=C2CC(C)(C)CC3=O |
| InChI | InChI=1S/C16H20O2/c1-10-4-5-16-8-12(10)13(17)6-11(16)7-15(2,3)9-14(16)18/h4,6,12H,5,7-9H2,1-3H3/t12-,16-/m1/s1 |
| InChIKey | HNYFEPMUHNBUCT-MLGOLLRUSA-N |
| XLogP | 3.23 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|