About 3-(methylamino)-2H-naphthalen-2-ide-1,4-dione;yttrium
3-(methylamino)-2H-naphthalen-2-ide-1,4-dione;yttrium (PubChem CID 153492678) has the molecular formula C11H8NO2Y-
and a molecular weight of 275.10 g/mol. Its IUPAC name is 3-(methylamino)-2H-naphthalen-2-ide-1,4-dione;yttrium.
Molecular Properties
| Compound Name | 3-(methylamino)-2H-naphthalen-2-ide-1,4-dione;yttrium |
| PubChem CID | 153492678 |
| Molecular Formula | C11H8NO2Y- |
| Molecular Weight | 275.10 g/mol |
| Exact Mass | 274.96 |
| IUPAC Name | 3-(methylamino)-2H-naphthalen-2-ide-1,4-dione;yttrium |
| SMILES | CNC1=[C-]C(=O)c2ccccc2C1=O.[Y] |
| InChI | InChI=1S/C11H8NO2.Y/c1-12-9-6-10(13)7-4-2-3-5-8(7)11(9)14;/h2-5,12H,1H3;/q-1; |
| InChIKey | KWIAHHXNOKLBOT-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.10 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 3-(methylamino)-2H-naphthalen-2-ide-1,4-dione;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(methylamino)-2H-naphthalen-2-ide-1,4-dione;yttrium?
The IUPAC name of 3-(methylamino)-2H-naphthalen-2-ide-1,4-dione;yttrium (CID 153492678) is 3-(methylamino)-2H-naphthalen-2-ide-1,4-dione;yttrium.
What is the SMILES notation for 3-(methylamino)-2H-naphthalen-2-ide-1,4-dione;yttrium?
The canonical SMILES for 3-(methylamino)-2H-naphthalen-2-ide-1,4-dione;yttrium is CNC1=[C-]C(=O)c2ccccc2C1=O.[Y].
What is the InChIKey of 3-(methylamino)-2H-naphthalen-2-ide-1,4-dione;yttrium?
The InChIKey is KWIAHHXNOKLBOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8NO2.Y/c1-12-9-6-10(13)7-4-2-3-5-8(7)11(9)14;/h2-5,12H,1H3;/q-1;.
What are the key properties of 3-(methylamino)-2H-naphthalen-2-ide-1,4-dione;yttrium?
3-(methylamino)-2H-naphthalen-2-ide-1,4-dione;yttrium has a molecular weight of 275.10 g/mol, XLogP of 0.97, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(methylamino)-2H-naphthalen-2-ide-1,4-dione;yttrium is sourced from PubChem (CID 153492678), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).