C14H13O2Re- — CID 59117699
3-tert-butyl-2H-naphthalen-2-ide-1,4-dione;rhenium (PubChem CID 59117699) has the molecular formula C14H13O2Re- and a molecular weight of 399.46 g/mol. Its IUPAC name is 3-tert-butyl-2H-naphthalen-2-ide-1,4-dione;rhenium.
| Compound Name | 3-tert-butyl-2H-naphthalen-2-ide-1,4-dione;rhenium |
|---|---|
| PubChem CID | 59117699 |
| Molecular Formula | C14H13O2Re- |
| Molecular Weight | 399.46 g/mol |
| Exact Mass | 400.05 |
| IUPAC Name | 3-tert-butyl-2H-naphthalen-2-ide-1,4-dione;rhenium |
| SMILES | CC(C)(C)C1=[C-]C(=O)c2ccccc2C1=O.[Re] |
| InChI | InChI=1S/C14H13O2.Re/c1-14(2,3)11-8-12(15)9-6-4-5-7-10(9)13(11)16;/h4-7H,1-3H3;/q-1; |
| InChIKey | VHTFIDWOWUZRRR-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.46 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|