C14H28Si — CID 153492765
[(2Z)-3,5-dimethyl-4-propan-2-ylhexa-2,4-dien-2-yl]-trimethylsilane (PubChem CID 153492765) has the molecular formula C14H28Si and a molecular weight of 224.46 g/mol. Its IUPAC name is [(2Z)-3,5-dimethyl-4-propan-2-ylhexa-2,4-dien-2-yl]-trimethylsilane.
| Compound Name | [(2Z)-3,5-dimethyl-4-propan-2-ylhexa-2,4-dien-2-yl]-trimethylsilane |
|---|---|
| PubChem CID | 153492765 |
| Molecular Formula | C14H28Si |
| Molecular Weight | 224.46 g/mol |
| Exact Mass | 224.20 |
| IUPAC Name | [(2Z)-3,5-dimethyl-4-propan-2-ylhexa-2,4-dien-2-yl]-trimethylsilane |
| SMILES | CC(C)=C(/C(C)=C(/C)[Si](C)(C)C)C(C)C |
| InChI | InChI=1S/C14H28Si/c1-10(2)14(11(3)4)12(5)13(6)15(7,8)9/h10H,1-9H3/b13-12- |
| InChIKey | OQVFUDBXOMXQSG-SEYXRHQNSA-N |
| XLogP | 5.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.46 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|