C4AlF3NO4- — CID 153499442
2,5,5-trifluoro-1,3,2-dioxaluminane-4,6-dione cyanide (PubChem CID 153499442) has the molecular formula C4AlF3NO4- and a molecular weight of 210.02 g/mol. Its IUPAC name is 2,5,5-trifluoro-1,3,2-dioxaluminane-4,6-dione cyanide.
| Compound Name | 2,5,5-trifluoro-1,3,2-dioxaluminane-4,6-dione cyanide |
|---|---|
| PubChem CID | 153499442 |
| Molecular Formula | C4AlF3NO4- |
| Molecular Weight | 210.02 g/mol |
| Exact Mass | 209.96 |
| IUPAC Name | 2,5,5-trifluoro-1,3,2-dioxaluminane-4,6-dione cyanide |
| SMILES | O=C1O[Al](F)OC(=O)C1(F)F.[C-]#N |
| InChI | InChI=1S/C3H2F2O4.CN.Al.FH/c4-3(5,1(6)7)2(8)9;1-2;;/h(H,6,7)(H,8,9);;;1H/q;-1;+3;/p-3 |
| InChIKey | LKHBJVNOTHXAAK-UHFFFAOYSA-K |
| XLogP | -0.23 |
| TPSA | 76.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.02 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|