C17H19NO3 — CID 15350552
(E,2E)-2-(4,4-dimethyl-1,3-oxazolidin-2-ylidene)-1-phenylhex-3-ene-1,5-dione (PubChem CID 15350552) has the molecular formula C17H19NO3 and a molecular weight of 285.34 g/mol. Its IUPAC name is (E,2E)-2-(4,4-dimethyl-1,3-oxazolidin-2-ylidene)-1-phenylhex-3-ene-1,5-dione.
| Compound Name | (E,2E)-2-(4,4-dimethyl-1,3-oxazolidin-2-ylidene)-1-phenylhex-3-ene-1,5-dione |
|---|---|
| PubChem CID | 15350552 |
| Molecular Formula | C17H19NO3 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.14 |
| IUPAC Name | (E,2E)-2-(4,4-dimethyl-1,3-oxazolidin-2-ylidene)-1-phenylhex-3-ene-1,5-dione |
| SMILES | CC(=O)/C=C/C(C(=O)c1ccccc1)=C1/NC(C)(C)CO1 |
| InChI | InChI=1S/C17H19NO3/c1-12(19)9-10-14(16-18-17(2,3)11-21-16)15(20)13-7-5-4-6-8-13/h4-10,18H,11H2,1-3H3/b10-9+,16-14+ |
| InChIKey | MPZJPCJHRHIWDZ-WAJBHNFBSA-N |
| XLogP | 2.62 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|