C8H13NS2 — CID 15350944
methyl (2Z)-N-methyl-2-methylsulfanylpenta-2,4-dienimidothioate (PubChem CID 15350944) has the molecular formula C8H13NS2 and a molecular weight of 187.33 g/mol. Its IUPAC name is methyl (2Z)-N-methyl-2-methylsulfanylpenta-2,4-dienimidothioate.
| Compound Name | methyl (2Z)-N-methyl-2-methylsulfanylpenta-2,4-dienimidothioate |
|---|---|
| PubChem CID | 15350944 |
| Molecular Formula | C8H13NS2 |
| Molecular Weight | 187.33 g/mol |
| Exact Mass | 187.05 |
| IUPAC Name | methyl (2Z)-N-methyl-2-methylsulfanylpenta-2,4-dienimidothioate |
| SMILES | C=C/C=C(SC)/C(=N/C)SC |
| InChI | InChI=1S/C8H13NS2/c1-5-6-7(10-3)8(9-2)11-4/h5-6H,1H2,2-4H3/b7-6-,9-8- |
| InChIKey | OSOPSXLVDCXLNW-JPDBVBESSA-N |
| XLogP | 2.81 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.33 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|