C16H27NO2Si — CID 15352812
(4S,5S)-2,2-dimethyl-4-phenyl-N-(trimethylsilylmethyl)-1,3-dioxan-5-amine (PubChem CID 15352812) has the molecular formula C16H27NO2Si and a molecular weight of 293.48 g/mol. Its IUPAC name is (4S,5S)-2,2-dimethyl-4-phenyl-N-(trimethylsilylmethyl)-1,3-dioxan-5-amine.
| Compound Name | (4S,5S)-2,2-dimethyl-4-phenyl-N-(trimethylsilylmethyl)-1,3-dioxan-5-amine |
|---|---|
| PubChem CID | 15352812 |
| Molecular Formula | C16H27NO2Si |
| Molecular Weight | 293.48 g/mol |
| Exact Mass | 293.18 |
| IUPAC Name | (4S,5S)-2,2-dimethyl-4-phenyl-N-(trimethylsilylmethyl)-1,3-dioxan-5-amine |
| SMILES | CC1(C)OC[C@H](NC[Si](C)(C)C)[C@H](c2ccccc2)O1 |
| InChI | InChI=1S/C16H27NO2Si/c1-16(2)18-11-14(17-12-20(3,4)5)15(19-16)13-9-7-6-8-10-13/h6-10,14-15,17H,11-12H2,1-5H3/t14-,15-/m0/s1 |
| InChIKey | BHEJYXPQZNLKDS-GJZGRUSLSA-N |
| XLogP | 3.35 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.48 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|