C14H24O2 — CID 15353120
(1S,7R,8S,8aR)-7-butyl-1,2,3,4,6,7,8,8a-octahydronaphthalene-1,8-diol (PubChem CID 15353120) has the molecular formula C14H24O2 and a molecular weight of 224.34 g/mol. Its IUPAC name is (1S,7R,8S,8aR)-7-butyl-1,2,3,4,6,7,8,8a-octahydronaphthalene-1,8-diol.
| Compound Name | (1S,7R,8S,8aR)-7-butyl-1,2,3,4,6,7,8,8a-octahydronaphthalene-1,8-diol |
|---|---|
| PubChem CID | 15353120 |
| Molecular Formula | C14H24O2 |
| Molecular Weight | 224.34 g/mol |
| Exact Mass | 224.18 |
| IUPAC Name | (1S,7R,8S,8aR)-7-butyl-1,2,3,4,6,7,8,8a-octahydronaphthalene-1,8-diol |
| SMILES | CCCC[C@@H]1CC=C2CCC[C@H](O)[C@@H]2[C@H]1O |
| InChI | InChI=1S/C14H24O2/c1-2-3-5-11-9-8-10-6-4-7-12(15)13(10)14(11)16/h8,11-16H,2-7,9H2,1H3/t11-,12+,13-,14+/m1/s1 |
| InChIKey | NJZKEBDPDYYFDL-RQJABVFESA-N |
| XLogP | 2.64 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.34 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|