C18H35N5 — CID 15353749
2-(N,N'-dicyclohexylcarbamimidoyl)-1,1,3,3-tetramethylguanidine (PubChem CID 15353749) has the molecular formula C18H35N5 and a molecular weight of 321.51 g/mol. Its IUPAC name is 2-(N,N'-dicyclohexylcarbamimidoyl)-1,1,3,3-tetramethylguanidine.
| Compound Name | 2-(N,N'-dicyclohexylcarbamimidoyl)-1,1,3,3-tetramethylguanidine |
|---|---|
| PubChem CID | 15353749 |
| Molecular Formula | C18H35N5 |
| Molecular Weight | 321.51 g/mol |
| Exact Mass | 321.29 |
| IUPAC Name | 2-(N,N'-dicyclohexylcarbamimidoyl)-1,1,3,3-tetramethylguanidine |
| SMILES | CN(C)C(=N/C(=N\C1CCCCC1)NC1CCCCC1)N(C)C |
| InChI | InChI=1S/C18H35N5/c1-22(2)18(23(3)4)21-17(19-15-11-7-5-8-12-15)20-16-13-9-6-10-14-16/h15-16H,5-14H2,1-4H3,(H,19,20) |
| InChIKey | OVEVRHPFUYEGGR-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 43.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.51 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|