C22H36O7Si — CID 15362856
dimethyl 2-[(E)-4-[2-[tert-butyl(dimethyl)silyl]oxy-2-ethenyl-1-methoxycarbonylcyclopropyl]but-2-enyl]propanedioate (PubChem CID 15362856) has the molecular formula C22H36O7Si and a molecular weight of 440.61 g/mol. Its IUPAC name is dimethyl 2-[(E)-4-[2-[tert-butyl(dimethyl)silyl]oxy-2-ethenyl-1-methoxycarbonylcyclopropyl]but-2-enyl]propanedioate.
| Compound Name | dimethyl 2-[(E)-4-[2-[tert-butyl(dimethyl)silyl]oxy-2-ethenyl-1-methoxycarbonylcyclopropyl]but-2-enyl]propanedioate |
|---|---|
| PubChem CID | 15362856 |
| Molecular Formula | C22H36O7Si |
| Molecular Weight | 440.61 g/mol |
| Exact Mass | 440.22 |
| IUPAC Name | dimethyl 2-[(E)-4-[2-[tert-butyl(dimethyl)silyl]oxy-2-ethenyl-1-methoxycarbonylcyclopropyl]but-2-enyl]propanedioate |
| SMILES | C=CC1(O[Si](C)(C)C(C)(C)C)CC1(C/C=C/CC(C(=O)OC)C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C22H36O7Si/c1-10-22(29-30(8,9)20(2,3)4)15-21(22,19(25)28-7)14-12-11-13-16(17(23)26-5)18(24)27-6/h10-12,16H,1,13-15H2,2-9H3/b12-11+ |
| InChIKey | ZISIKJHZSLKSGZ-VAWYXSNFSA-N |
| XLogP | 3.79 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.61 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|