C21H21NO6 — CID 15364123
ethyl (4aR,7aR)-7a-hydroxy-5-oxo-3,3-diphenyl-6,7-dihydro-4H-[1,2]dioxino[3,4-c]pyrrole-4a-carboxylate (PubChem CID 15364123) has the molecular formula C21H21NO6 and a molecular weight of 383.40 g/mol. Its IUPAC name is ethyl (4aR,7aR)-7a-hydroxy-5-oxo-3,3-diphenyl-6,7-dihydro-4H-[1,2]dioxino[3,4-c]pyrrole-4a-carboxylate.
| Compound Name | ethyl (4aR,7aR)-7a-hydroxy-5-oxo-3,3-diphenyl-6,7-dihydro-4H-[1,2]dioxino[3,4-c]pyrrole-4a-carboxylate |
|---|---|
| PubChem CID | 15364123 |
| Molecular Formula | C21H21NO6 |
| Molecular Weight | 383.40 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | ethyl (4aR,7aR)-7a-hydroxy-5-oxo-3,3-diphenyl-6,7-dihydro-4H-[1,2]dioxino[3,4-c]pyrrole-4a-carboxylate |
| SMILES | CCOC(=O)[C@]12CC(c3ccccc3)(c3ccccc3)OO[C@@]1(O)CNC2=O |
| InChI | InChI=1S/C21H21NO6/c1-2-26-18(24)19-13-20(15-9-5-3-6-10-15,16-11-7-4-8-12-16)27-28-21(19,25)14-22-17(19)23/h3-12,25H,2,13-14H2,1H3,(H,22,23)/t19-,21+/m1/s1 |
| InChIKey | TVBZQSCOHPQFRG-CTNGQTDRSA-N |
| XLogP | 1.65 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.40 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|