C12H18O5 — CID 15367226
diethyl 4-ethyl-2,5-dihydrofuran-2,3-dicarboxylate (PubChem CID 15367226) has the molecular formula C12H18O5 and a molecular weight of 242.27 g/mol. Its IUPAC name is diethyl 4-ethyl-2,5-dihydrofuran-2,3-dicarboxylate.
| Compound Name | diethyl 4-ethyl-2,5-dihydrofuran-2,3-dicarboxylate |
|---|---|
| PubChem CID | 15367226 |
| Molecular Formula | C12H18O5 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | diethyl 4-ethyl-2,5-dihydrofuran-2,3-dicarboxylate |
| SMILES | CCOC(=O)C1=C(CC)COC1C(=O)OCC |
| InChI | InChI=1S/C12H18O5/c1-4-8-7-17-10(12(14)16-6-3)9(8)11(13)15-5-2/h10H,4-7H2,1-3H3 |
| InChIKey | QPDPZYNLEYOUSW-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |