(1,5-dioxo-4-phosphonopentan-2-yl)phosphonic acid

C5H10O8P2 — CID 15371971

IUPAC(1,5-dioxo-4-phosphonopentan-2-yl)phosphonic acid
SMILESO=CC(CC(C=O)P(=O)(O)O)P(=O)(O)O
InChIInChI=1S/C5H10O8P2/c6-2-4(14(8,9)10)1-5(3-7)15(11,12)13/h2-5H,1H2,(H2,8,9,10)(H2,11,12,13)
InChIKeyFJJZOCOQHCJPTQ-UHFFFAOYSA-N
MW260.07 g/mol
LogP-1.13
Rot. Bonds6

About (1,5-dioxo-4-phosphonopentan-2-yl)phosphonic acid

(1,5-dioxo-4-phosphonopentan-2-yl)phosphonic acid (PubChem CID 15371971) has the molecular formula C5H10O8P2 and a molecular weight of 260.07 g/mol. Its IUPAC name is (1,5-dioxo-4-phosphonopentan-2-yl)phosphonic acid.

Molecular Properties

Compound Name(1,5-dioxo-4-phosphonopentan-2-yl)phosphonic acid
PubChem CID15371971
Molecular FormulaC5H10O8P2
Molecular Weight260.07 g/mol
Exact Mass259.99
IUPAC Name(1,5-dioxo-4-phosphonopentan-2-yl)phosphonic acid
SMILESO=CC(CC(C=O)P(=O)(O)O)P(=O)(O)O
InChIInChI=1S/C5H10O8P2/c6-2-4(14(8,9)10)1-5(3-7)15(11,12)13/h2-5H,1H2,(H2,8,9,10)(H2,11,12,13)
InChIKeyFJJZOCOQHCJPTQ-UHFFFAOYSA-N
XLogP-1.13
TPSA149.20 Ų
H-Bond Donors4
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500260.07
LogP ≤ 5-1.13
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze (1,5-dioxo-4-phosphonopentan-2-yl)phosphonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (1,5-dioxo-4-phosphonopentan-2-yl)phosphonic acid?
The IUPAC name of (1,5-dioxo-4-phosphonopentan-2-yl)phosphonic acid (CID 15371971) is (1,5-dioxo-4-phosphonopentan-2-yl)phosphonic acid.
What is the SMILES notation for (1,5-dioxo-4-phosphonopentan-2-yl)phosphonic acid?
The canonical SMILES for (1,5-dioxo-4-phosphonopentan-2-yl)phosphonic acid is O=CC(CC(C=O)P(=O)(O)O)P(=O)(O)O.
What is the InChIKey of (1,5-dioxo-4-phosphonopentan-2-yl)phosphonic acid?
The InChIKey is FJJZOCOQHCJPTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10O8P2/c6-2-4(14(8,9)10)1-5(3-7)15(11,12)13/h2-5H,1H2,(H2,8,9,10)(H2,11,12,13).
What are the key properties of (1,5-dioxo-4-phosphonopentan-2-yl)phosphonic acid?
(1,5-dioxo-4-phosphonopentan-2-yl)phosphonic acid has a molecular weight of 260.07 g/mol, XLogP of -1.13, 6 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1,5-dioxo-4-phosphonopentan-2-yl)phosphonic acid is sourced from PubChem (CID 15371971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).