C5H10O8P2 — CID 15371971
(1,5-dioxo-4-phosphonopentan-2-yl)phosphonic acid (PubChem CID 15371971) has the molecular formula C5H10O8P2 and a molecular weight of 260.07 g/mol. Its IUPAC name is (1,5-dioxo-4-phosphonopentan-2-yl)phosphonic acid.
| Compound Name | (1,5-dioxo-4-phosphonopentan-2-yl)phosphonic acid |
|---|---|
| PubChem CID | 15371971 |
| Molecular Formula | C5H10O8P2 |
| Molecular Weight | 260.07 g/mol |
| Exact Mass | 259.99 |
| IUPAC Name | (1,5-dioxo-4-phosphonopentan-2-yl)phosphonic acid |
| SMILES | O=CC(CC(C=O)P(=O)(O)O)P(=O)(O)O |
| InChI | InChI=1S/C5H10O8P2/c6-2-4(14(8,9)10)1-5(3-7)15(11,12)13/h2-5H,1H2,(H2,8,9,10)(H2,11,12,13) |
| InChIKey | FJJZOCOQHCJPTQ-UHFFFAOYSA-N |
| XLogP | -1.13 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.07 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|