C25H40O5 — CID 15395682
[(5S,6E,10E)-2-hydroxy-2,6,10-trimethyl-12-(oxan-2-yloxy)dodeca-6,10-dien-3-yn-5-yl] 2,2-dimethylpropanoate (PubChem CID 15395682) has the molecular formula C25H40O5 and a molecular weight of 420.59 g/mol. Its IUPAC name is [(5S,6E,10E)-2-hydroxy-2,6,10-trimethyl-12-(oxan-2-yloxy)dodeca-6,10-dien-3-yn-5-yl] 2,2-dimethylpropanoate.
| Compound Name | [(5S,6E,10E)-2-hydroxy-2,6,10-trimethyl-12-(oxan-2-yloxy)dodeca-6,10-dien-3-yn-5-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 15395682 |
| Molecular Formula | C25H40O5 |
| Molecular Weight | 420.59 g/mol |
| Exact Mass | 420.29 |
| IUPAC Name | [(5S,6E,10E)-2-hydroxy-2,6,10-trimethyl-12-(oxan-2-yloxy)dodeca-6,10-dien-3-yn-5-yl] 2,2-dimethylpropanoate |
| SMILES | C/C(=C\COC1CCCCO1)CC/C=C(\C)[C@@H](C#CC(C)(C)O)OC(=O)C(C)(C)C |
| InChI | InChI=1S/C25H40O5/c1-19(15-18-29-22-13-8-9-17-28-22)11-10-12-20(2)21(14-16-25(6,7)27)30-23(26)24(3,4)5/h12,15,21-22,27H,8-11,13,17-18H2,1-7H3/b19-15+,20-12+/t21-,22?/m1/s1 |
| InChIKey | OGRJSVFHHIAUOM-LHPWAKPXSA-N |
| XLogP | 4.93 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.59 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|