C14H20N4O3 — CID 15399142
tert-butyl N-[7-(3-hydroxypropyl)benzotriazol-1-yl]carbamate (PubChem CID 15399142) has the molecular formula C14H20N4O3 and a molecular weight of 292.34 g/mol. Its IUPAC name is tert-butyl N-[7-(3-hydroxypropyl)benzotriazol-1-yl]carbamate.
| Compound Name | tert-butyl N-[7-(3-hydroxypropyl)benzotriazol-1-yl]carbamate |
|---|---|
| PubChem CID | 15399142 |
| Molecular Formula | C14H20N4O3 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | tert-butyl N-[7-(3-hydroxypropyl)benzotriazol-1-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nn1nnc2cccc(CCCO)c21 |
| InChI | InChI=1S/C14H20N4O3/c1-14(2,3)21-13(20)16-18-12-10(7-5-9-19)6-4-8-11(12)15-17-18/h4,6,8,19H,5,7,9H2,1-3H3,(H,16,20) |
| InChIKey | VLCMDQDGCGKINI-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |