C25H38N4O5 — CID 154003759
4-[2-[2-(2-aminoethoxy)ethoxy]ethylamino]-8-[1-[2-[2-(2-aminoethoxy)ethoxy]ethylamino]ethenyl]naphthalene-1-carbaldehyde (PubChem CID 154003759) has the molecular formula C25H38N4O5 and a molecular weight of 474.60 g/mol. Its IUPAC name is 4-[2-[2-(2-aminoethoxy)ethoxy]ethylamino]-8-[1-[2-[2-(2-aminoethoxy)ethoxy]ethylamino]ethenyl]naphthalene-1-carbaldehyde.
| Compound Name | 4-[2-[2-(2-aminoethoxy)ethoxy]ethylamino]-8-[1-[2-[2-(2-aminoethoxy)ethoxy]ethylamino]ethenyl]naphthalene-1-carbaldehyde |
|---|---|
| PubChem CID | 154003759 |
| Molecular Formula | C25H38N4O5 |
| Molecular Weight | 474.60 g/mol |
| Exact Mass | 474.28 |
| IUPAC Name | 4-[2-[2-(2-aminoethoxy)ethoxy]ethylamino]-8-[1-[2-[2-(2-aminoethoxy)ethoxy]ethylamino]ethenyl]naphthalene-1-carbaldehyde |
| SMILES | C=C(NCCOCCOCCN)c1cccc2c(NCCOCCOCCN)ccc(C=O)c12 |
| InChI | InChI=1S/C25H38N4O5/c1-20(28-9-13-33-17-15-31-11-7-26)22-3-2-4-23-24(6-5-21(19-30)25(22)23)29-10-14-34-18-16-32-12-8-27/h2-6,19,28-29H,1,7-18,26-27H2 |
| InChIKey | NBMJSFQYXGZCNM-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 130.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.60 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|