C26H39ClN4O4 — CID 154006207
4-[[2-[4-(1-butoxycarbonylpyrrolidin-2-yl)piperidin-1-yl]-4-chlorophenyl]methyl]piperazine-1-carboxylic acid (PubChem CID 154006207) has the molecular formula C26H39ClN4O4 and a molecular weight of 507.08 g/mol. Its IUPAC name is 4-[[2-[4-(1-butoxycarbonylpyrrolidin-2-yl)piperidin-1-yl]-4-chlorophenyl]methyl]piperazine-1-carboxylic acid.
| Compound Name | 4-[[2-[4-(1-butoxycarbonylpyrrolidin-2-yl)piperidin-1-yl]-4-chlorophenyl]methyl]piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 154006207 |
| Molecular Formula | C26H39ClN4O4 |
| Molecular Weight | 507.08 g/mol |
| Exact Mass | 506.27 |
| IUPAC Name | 4-[[2-[4-(1-butoxycarbonylpyrrolidin-2-yl)piperidin-1-yl]-4-chlorophenyl]methyl]piperazine-1-carboxylic acid |
| SMILES | CCCCOC(=O)N1CCCC1C1CCN(c2cc(Cl)ccc2CN2CCN(C(=O)O)CC2)CC1 |
| InChI | InChI=1S/C26H39ClN4O4/c1-2-3-17-35-26(34)31-10-4-5-23(31)20-8-11-29(12-9-20)24-18-22(27)7-6-21(24)19-28-13-15-30(16-14-28)25(32)33/h6-7,18,20,23H,2-5,8-17,19H2,1H3,(H,32,33) |
| InChIKey | LJEQTZHPBYCOLD-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 76.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.08 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|