C17H24Si — CID 15400973
dimethyl-(3-methylocta-1,2,7-trienyl)-phenylsilane (PubChem CID 15400973) has the molecular formula C17H24Si and a molecular weight of 256.46 g/mol. Its IUPAC name is dimethyl-(3-methylocta-1,2,7-trienyl)-phenylsilane.
| Compound Name | dimethyl-(3-methylocta-1,2,7-trienyl)-phenylsilane |
|---|---|
| PubChem CID | 15400973 |
| Molecular Formula | C17H24Si |
| Molecular Weight | 256.46 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | dimethyl-(3-methylocta-1,2,7-trienyl)-phenylsilane |
| SMILES | C=CCCCC(C)=C=C[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C17H24Si/c1-5-6-8-11-16(2)14-15-18(3,4)17-12-9-7-10-13-17/h5,7,9-10,12-13,15H,1,6,8,11H2,2-4H3 |
| InChIKey | XLEWJKRTEZEQLA-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.46 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|