C9H7F4NO — CID 154023673
2,2,4,4-tetradeuterio-3-(2,3,5,6-tetrafluorophenoxy)azetidine (PubChem CID 154023673) has the molecular formula C9H7F4NO and a molecular weight of 225.18 g/mol. Its IUPAC name is 2,2,4,4-tetradeuterio-3-(2,3,5,6-tetrafluorophenoxy)azetidine.
| Compound Name | 2,2,4,4-tetradeuterio-3-(2,3,5,6-tetrafluorophenoxy)azetidine |
|---|---|
| PubChem CID | 154023673 |
| Molecular Formula | C9H7F4NO |
| Molecular Weight | 225.18 g/mol |
| Exact Mass | 225.07 |
| IUPAC Name | 2,2,4,4-tetradeuterio-3-(2,3,5,6-tetrafluorophenoxy)azetidine |
| SMILES | [2H]C1([2H])NC([2H])([2H])C1Oc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C9H7F4NO/c10-5-1-6(11)8(13)9(7(5)12)15-4-2-14-3-4/h1,4,14H,2-3H2/i2D2,3D2 |
| InChIKey | UGLPJXJCBSHGRH-RRVWJQJTSA-N |
| XLogP | 1.59 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.18 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|