C6H6F4OSi2 — CID 173127343
silyl-(2,3,5,6-tetrafluorophenoxy)silane (PubChem CID 173127343) has the molecular formula C6H6F4OSi2 and a molecular weight of 226.28 g/mol. Its IUPAC name is silyl-(2,3,5,6-tetrafluorophenoxy)silane.
| Compound Name | silyl-(2,3,5,6-tetrafluorophenoxy)silane |
|---|---|
| PubChem CID | 173127343 |
| Molecular Formula | C6H6F4OSi2 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 225.99 |
| IUPAC Name | silyl-(2,3,5,6-tetrafluorophenoxy)silane |
| SMILES | Fc1cc(F)c(F)c(O[SiH2][SiH3])c1F |
| InChI | InChI=1S/C6H6F4OSi2/c7-2-1-3(8)5(10)6(4(2)9)11-13-12/h1H,13H2,12H3 |
| InChIKey | QNPHQAWJGCLMEQ-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|