C14H9Br2NO2 — CID 154033651
N-(2,4-dibromo-6-formylphenyl)benzamide (PubChem CID 154033651) has the molecular formula C14H9Br2NO2 and a molecular weight of 383.04 g/mol. Its IUPAC name is N-(2,4-dibromo-6-formylphenyl)benzamide.
| Compound Name | N-(2,4-dibromo-6-formylphenyl)benzamide |
|---|---|
| PubChem CID | 154033651 |
| Molecular Formula | C14H9Br2NO2 |
| Molecular Weight | 383.04 g/mol |
| Exact Mass | 380.90 |
| IUPAC Name | N-(2,4-dibromo-6-formylphenyl)benzamide |
| SMILES | O=Cc1cc(Br)cc(Br)c1NC(=O)c1ccccc1 |
| InChI | InChI=1S/C14H9Br2NO2/c15-11-6-10(8-18)13(12(16)7-11)17-14(19)9-4-2-1-3-5-9/h1-8H,(H,17,19) |
| InChIKey | FAAXYHSLFCLMEH-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.04 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|