C4H3FN2O2 — CID 154036926
4-fluoro-1,2-oxazole-3-carboxamide (PubChem CID 154036926) has the molecular formula C4H3FN2O2 and a molecular weight of 130.08 g/mol. Its IUPAC name is 4-fluoro-1,2-oxazole-3-carboxamide.
| Compound Name | 4-fluoro-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 154036926 |
| Molecular Formula | C4H3FN2O2 |
| Molecular Weight | 130.08 g/mol |
| Exact Mass | 130.02 |
| IUPAC Name | 4-fluoro-1,2-oxazole-3-carboxamide |
| SMILES | NC(=O)c1nocc1F |
| InChI | InChI=1S/C4H3FN2O2/c5-2-1-9-7-3(2)4(6)8/h1H,(H2,6,8) |
| InChIKey | XIPYGJAKOMCOFC-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 69.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.08 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |