C16H20N2O2S2 — CID 154044726
4-methyl-N-[methyl-[1-(6-methyl-3-pyridinyl)ethyl]-λ4-sulfanylidene]benzenesulfonamide (PubChem CID 154044726) has the molecular formula C16H20N2O2S2 and a molecular weight of 336.48 g/mol. Its IUPAC name is 4-methyl-N-[methyl-[1-(6-methyl-3-pyridinyl)ethyl]-λ4-sulfanylidene]benzenesulfonamide.
| Compound Name | 4-methyl-N-[methyl-[1-(6-methyl-3-pyridinyl)ethyl]-λ4-sulfanylidene]benzenesulfonamide |
|---|---|
| PubChem CID | 154044726 |
| Molecular Formula | C16H20N2O2S2 |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | 4-methyl-N-[methyl-[1-(6-methyl-3-pyridinyl)ethyl]-λ4-sulfanylidene]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N=S(C)C(C)c2ccc(C)nc2)cc1 |
| InChI | InChI=1S/C16H20N2O2S2/c1-12-5-9-16(10-6-12)22(19,20)18-21(4)14(3)15-8-7-13(2)17-11-15/h5-11,14H,1-4H3 |
| InChIKey | ZOCMXKUZTPJBNZ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 59.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |