C8H11F4O3S- — CID 154047315
[2-fluoro-1-(2,2,2-trifluoroethyl)cyclohexyl] sulfite (PubChem CID 154047315) has the molecular formula C8H11F4O3S- and a molecular weight of 263.23 g/mol. Its IUPAC name is [2-fluoro-1-(2,2,2-trifluoroethyl)cyclohexyl] sulfite.
| Compound Name | [2-fluoro-1-(2,2,2-trifluoroethyl)cyclohexyl] sulfite |
|---|---|
| PubChem CID | 154047315 |
| Molecular Formula | C8H11F4O3S- |
| Molecular Weight | 263.23 g/mol |
| Exact Mass | 263.04 |
| IUPAC Name | [2-fluoro-1-(2,2,2-trifluoroethyl)cyclohexyl] sulfite |
| SMILES | O=S([O-])OC1(CC(F)(F)F)CCCCC1F |
| InChI | InChI=1S/C8H12F4O3S/c9-6-3-1-2-4-7(6,15-16(13)14)5-8(10,11)12/h6H,1-5H2,(H,13,14)/p-1 |
| InChIKey | MYIDXDRHOLGASP-UHFFFAOYSA-M |
| XLogP | 2.40 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.23 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|