C10H15F6O3P — CID 87155145
[1,2-bis(2,2,2-trifluoroethyl)cyclohexyl]phosphonic acid (PubChem CID 87155145) has the molecular formula C10H15F6O3P and a molecular weight of 328.19 g/mol. Its IUPAC name is [1,2-bis(2,2,2-trifluoroethyl)cyclohexyl]phosphonic acid.
| Compound Name | [1,2-bis(2,2,2-trifluoroethyl)cyclohexyl]phosphonic acid |
|---|---|
| PubChem CID | 87155145 |
| Molecular Formula | C10H15F6O3P |
| Molecular Weight | 328.19 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | [1,2-bis(2,2,2-trifluoroethyl)cyclohexyl]phosphonic acid |
| SMILES | O=P(O)(O)C1(CC(F)(F)F)CCCCC1CC(F)(F)F |
| InChI | InChI=1S/C10H15F6O3P/c11-9(12,13)5-7-3-1-2-4-8(7,20(17,18)19)6-10(14,15)16/h7H,1-6H2,(H2,17,18,19) |
| InChIKey | UXQAIXGJOUMCKI-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.19 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|