C10H16F3O3P-2 — CID 154078614
[2-ethyl-1-(2,2,2-trifluoroethyl)cyclohexyl]-dioxido-oxo-λ5-phosphane (PubChem CID 154078614) has the molecular formula C10H16F3O3P-2 and a molecular weight of 272.20 g/mol. Its IUPAC name is [2-ethyl-1-(2,2,2-trifluoroethyl)cyclohexyl]-dioxido-oxo-λ5-phosphane.
| Compound Name | [2-ethyl-1-(2,2,2-trifluoroethyl)cyclohexyl]-dioxido-oxo-λ5-phosphane |
|---|---|
| PubChem CID | 154078614 |
| Molecular Formula | C10H16F3O3P-2 |
| Molecular Weight | 272.20 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | [2-ethyl-1-(2,2,2-trifluoroethyl)cyclohexyl]-dioxido-oxo-λ5-phosphane |
| SMILES | CCC1CCCCC1(CC(F)(F)F)P(=O)([O-])[O-] |
| InChI | InChI=1S/C10H18F3O3P/c1-2-8-5-3-4-6-9(8,17(14,15)16)7-10(11,12)13/h8H,2-7H2,1H3,(H2,14,15,16)/p-2 |
| InChIKey | YHNVZHSAVTWNTB-UHFFFAOYSA-L |
| XLogP | 2.19 |
| TPSA | 63.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.20 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|