C11H18F6NO3P — CID 140667519
[2-ethyl-2,3-bis(2,2,2-trifluoroethyl)piperidin-1-yl]phosphonic acid (PubChem CID 140667519) has the molecular formula C11H18F6NO3P and a molecular weight of 357.23 g/mol. Its IUPAC name is [2-ethyl-2,3-bis(2,2,2-trifluoroethyl)piperidin-1-yl]phosphonic acid.
| Compound Name | [2-ethyl-2,3-bis(2,2,2-trifluoroethyl)piperidin-1-yl]phosphonic acid |
|---|---|
| PubChem CID | 140667519 |
| Molecular Formula | C11H18F6NO3P |
| Molecular Weight | 357.23 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | [2-ethyl-2,3-bis(2,2,2-trifluoroethyl)piperidin-1-yl]phosphonic acid |
| SMILES | CCC1(CC(F)(F)F)C(CC(F)(F)F)CCCN1P(=O)(O)O |
| InChI | InChI=1S/C11H18F6NO3P/c1-2-9(7-11(15,16)17)8(6-10(12,13)14)4-3-5-18(9)22(19,20)21/h8H,2-7H2,1H3,(H2,19,20,21) |
| InChIKey | ZPIGRKUOTHGSPX-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.23 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|