C9H15F4O3P — CID 66796815
[2-fluoro-2-methyl-1-(2,2,2-trifluoroethyl)cyclohexyl]phosphonic acid (PubChem CID 66796815) has the molecular formula C9H15F4O3P and a molecular weight of 278.18 g/mol. Its IUPAC name is [2-fluoro-2-methyl-1-(2,2,2-trifluoroethyl)cyclohexyl]phosphonic acid.
| Compound Name | [2-fluoro-2-methyl-1-(2,2,2-trifluoroethyl)cyclohexyl]phosphonic acid |
|---|---|
| PubChem CID | 66796815 |
| Molecular Formula | C9H15F4O3P |
| Molecular Weight | 278.18 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | [2-fluoro-2-methyl-1-(2,2,2-trifluoroethyl)cyclohexyl]phosphonic acid |
| SMILES | CC1(F)CCCCC1(CC(F)(F)F)P(=O)(O)O |
| InChI | InChI=1S/C9H15F4O3P/c1-7(10)4-2-3-5-8(7,17(14,15)16)6-9(11,12)13/h2-6H2,1H3,(H2,14,15,16) |
| InChIKey | IJYMJFINCVNMLX-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.18 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|