C10H18F3O2P — CID 23597222
[(4-ethyl-4-methylcyclohexyl)-difluoromethyl]-fluorophosphinic acid (PubChem CID 23597222) has the molecular formula C10H18F3O2P and a molecular weight of 258.22 g/mol. Its IUPAC name is [(4-ethyl-4-methylcyclohexyl)-difluoromethyl]-fluorophosphinic acid.
| Compound Name | [(4-ethyl-4-methylcyclohexyl)-difluoromethyl]-fluorophosphinic acid |
|---|---|
| PubChem CID | 23597222 |
| Molecular Formula | C10H18F3O2P |
| Molecular Weight | 258.22 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | [(4-ethyl-4-methylcyclohexyl)-difluoromethyl]-fluorophosphinic acid |
| SMILES | CCC1(C)CCC(C(F)(F)P(=O)(O)F)CC1 |
| InChI | InChI=1S/C10H18F3O2P/c1-3-9(2)6-4-8(5-7-9)10(11,12)16(13,14)15/h8H,3-7H2,1-2H3,(H,14,15) |
| InChIKey | AYIAHLCSWQRKSV-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.22 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|