C9H10N2O6S2 — CID 154057562
1-(2-sulfoethyl)benzimidazole-5-sulfonic acid (PubChem CID 154057562) has the molecular formula C9H10N2O6S2 and a molecular weight of 306.32 g/mol. Its IUPAC name is 1-(2-sulfoethyl)benzimidazole-5-sulfonic acid.
| Compound Name | 1-(2-sulfoethyl)benzimidazole-5-sulfonic acid |
|---|---|
| PubChem CID | 154057562 |
| Molecular Formula | C9H10N2O6S2 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.00 |
| IUPAC Name | 1-(2-sulfoethyl)benzimidazole-5-sulfonic acid |
| SMILES | O=S(=O)(O)CCn1cnc2cc(S(=O)(=O)O)ccc21 |
| InChI | InChI=1S/C9H10N2O6S2/c12-18(13,14)4-3-11-6-10-8-5-7(19(15,16)17)1-2-9(8)11/h1-2,5-6H,3-4H2,(H,12,13,14)(H,15,16,17) |
| InChIKey | HEPNHDYEQAMBCA-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 126.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|