C26H40N8O2S — CID 154058083
N-[2-[4-[[amino-[[amino-(2-methylpiperidin-1-yl)methylidene]amino]methylidene]amino]phenyl]ethyl]-5-(2-oxo-1,3,3a,5,6,6a-hexahydrothieno[2,3-d]imidazol-5-yl)pentanamide (PubChem CID 154058083) has the molecular formula C26H40N8O2S and a molecular weight of 528.73 g/mol. Its IUPAC name is N-[2-[4-[[amino-[[amino-(2-methylpiperidin-1-yl)methylidene]amino]methylidene]amino]phenyl]ethyl]-5-(2-oxo-1,3,3a,5,6,6a-hexahydrothieno[2,3-d]imidazol-5-yl)pentanamide.
| Compound Name | N-[2-[4-[[amino-[[amino-(2-methylpiperidin-1-yl)methylidene]amino]methylidene]amino]phenyl]ethyl]-5-(2-oxo-1,3,3a,5,6,6a-hexahydrothieno[2,3-d]imidazol-5-yl)pentanamide |
|---|---|
| PubChem CID | 154058083 |
| Molecular Formula | C26H40N8O2S |
| Molecular Weight | 528.73 g/mol |
| Exact Mass | 528.30 |
| IUPAC Name | N-[2-[4-[[amino-[[amino-(2-methylpiperidin-1-yl)methylidene]amino]methylidene]amino]phenyl]ethyl]-5-(2-oxo-1,3,3a,5,6,6a-hexahydrothieno[2,3-d]imidazol-5-yl)pentanamide |
| SMILES | CC1CCCCN1C(N)=N/C(N)=N/c1ccc(CCNC(=O)CCCCC2CC3NC(=O)NC3S2)cc1 |
| InChI | InChI=1S/C26H40N8O2S/c1-17-6-4-5-15-34(17)25(28)33-24(27)30-19-11-9-18(10-12-19)13-14-29-22(35)8-3-2-7-20-16-21-23(37-20)32-26(36)31-21/h9-12,17,20-21,23H,2-8,13-16H2,1H3,(H,29,35)(H2,31,32,36)(H4,27,28,30,33) |
| InChIKey | MMTKVQOFKWHNFI-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 150.23 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.73 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|