C14H30O2Si — CID 154063954
(3-tert-butyl-2,2,5,5-tetramethylhex-3-en-4-yl)peroxysilane (PubChem CID 154063954) has the molecular formula C14H30O2Si and a molecular weight of 258.48 g/mol. Its IUPAC name is (3-tert-butyl-2,2,5,5-tetramethylhex-3-en-4-yl)peroxysilane.
| Compound Name | (3-tert-butyl-2,2,5,5-tetramethylhex-3-en-4-yl)peroxysilane |
|---|---|
| PubChem CID | 154063954 |
| Molecular Formula | C14H30O2Si |
| Molecular Weight | 258.48 g/mol |
| Exact Mass | 258.20 |
| IUPAC Name | (3-tert-butyl-2,2,5,5-tetramethylhex-3-en-4-yl)peroxysilane |
| SMILES | CC(C)(C)C(OO[SiH3])=C(C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C14H30O2Si/c1-12(2,3)10(13(4,5)6)11(15-16-17)14(7,8)9/h1-9,17H3 |
| InChIKey | YSVVDQDTIDRCLM-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.48 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|