C15H16N2O4S2 — CID 154070964
(2S)-2-amino-N-hydroxy-2-(4-phenylphenyl)sulfonyl-3-sulfanylpropanamide (PubChem CID 154070964) has the molecular formula C15H16N2O4S2 and a molecular weight of 352.44 g/mol. Its IUPAC name is (2S)-2-amino-N-hydroxy-2-(4-phenylphenyl)sulfonyl-3-sulfanylpropanamide.
| Compound Name | (2S)-2-amino-N-hydroxy-2-(4-phenylphenyl)sulfonyl-3-sulfanylpropanamide |
|---|---|
| PubChem CID | 154070964 |
| Molecular Formula | C15H16N2O4S2 |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.06 |
| IUPAC Name | (2S)-2-amino-N-hydroxy-2-(4-phenylphenyl)sulfonyl-3-sulfanylpropanamide |
| SMILES | N[C@@](CS)(C(=O)NO)S(=O)(=O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C15H16N2O4S2/c16-15(10-22,14(18)17-19)23(20,21)13-8-6-12(7-9-13)11-4-2-1-3-5-11/h1-9,19,22H,10,16H2,(H,17,18)/t15-/m1/s1 |
| InChIKey | RIPKNDQXUOEHNZ-OAHLLOKOSA-N |
| XLogP | 1.22 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|