C18H34N6O3 — CID 15408076
(2R)-N-[2-[[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-2-oxoethyl]-N-(2-methylpropyl)piperidine-2-carboxamide (PubChem CID 15408076) has the molecular formula C18H34N6O3 and a molecular weight of 382.51 g/mol. Its IUPAC name is (2R)-N-[2-[[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-2-oxoethyl]-N-(2-methylpropyl)piperidine-2-carboxamide.
| Compound Name | (2R)-N-[2-[[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-2-oxoethyl]-N-(2-methylpropyl)piperidine-2-carboxamide |
|---|---|
| PubChem CID | 15408076 |
| Molecular Formula | C18H34N6O3 |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.27 |
| IUPAC Name | (2R)-N-[2-[[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-2-oxoethyl]-N-(2-methylpropyl)piperidine-2-carboxamide |
| SMILES | CC(C)CN(CC(=O)N[C@H](C=O)CCCN=C(N)N)C(=O)[C@H]1CCCCN1 |
| InChI | InChI=1S/C18H34N6O3/c1-13(2)10-24(17(27)15-7-3-4-8-21-15)11-16(26)23-14(12-25)6-5-9-22-18(19)20/h12-15,21H,3-11H2,1-2H3,(H,23,26)(H4,19,20,22)/t14-,15+/m0/s1 |
| InChIKey | HDAADYLGQPPNGJ-LSDHHAIUSA-N |
| XLogP | -0.65 |
| TPSA | 142.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|