C17H34Cl2N6O3 — CID 45260967
(2R)-N-[2-[[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-2-oxoethyl]-N-propan-2-ylpiperidine-2-carboxamide;dihydrochloride (PubChem CID 45260967) has the molecular formula C17H34Cl2N6O3 and a molecular weight of 441.40 g/mol. Its IUPAC name is (2R)-N-[2-[[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-2-oxoethyl]-N-propan-2-ylpiperidine-2-carboxamide;dihydrochloride.
| Compound Name | (2R)-N-[2-[[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-2-oxoethyl]-N-propan-2-ylpiperidine-2-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 45260967 |
| Molecular Formula | C17H34Cl2N6O3 |
| Molecular Weight | 441.40 g/mol |
| Exact Mass | 440.21 |
| IUPAC Name | (2R)-N-[2-[[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-2-oxoethyl]-N-propan-2-ylpiperidine-2-carboxamide;dihydrochloride |
| SMILES | CC(C)N(CC(=O)N[C@H](C=O)CCCN=C(N)N)C(=O)[C@H]1CCCCN1.Cl.Cl |
| InChI | InChI=1S/C17H32N6O3.2ClH/c1-12(2)23(16(26)14-7-3-4-8-20-14)10-15(25)22-13(11-24)6-5-9-21-17(18)19;;/h11-14,20H,3-10H2,1-2H3,(H,22,25)(H4,18,19,21);2*1H/t13-,14+;;/m0../s1 |
| InChIKey | CFSDVVLBABUCGS-WICJZZOFSA-N |
| XLogP | -0.05 |
| TPSA | 142.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.40 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|