C9H8N2OS — CID 154081357
7-methylthieno[3,2-b]pyridine-6-carboxamide (PubChem CID 154081357) has the molecular formula C9H8N2OS and a molecular weight of 192.24 g/mol. Its IUPAC name is 7-methylthieno[3,2-b]pyridine-6-carboxamide.
| Compound Name | 7-methylthieno[3,2-b]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 154081357 |
| Molecular Formula | C9H8N2OS |
| Molecular Weight | 192.24 g/mol |
| Exact Mass | 192.04 |
| IUPAC Name | 7-methylthieno[3,2-b]pyridine-6-carboxamide |
| SMILES | Cc1c(C(N)=O)cnc2ccsc12 |
| InChI | InChI=1S/C9H8N2OS/c1-5-6(9(10)12)4-11-7-2-3-13-8(5)7/h2-4H,1H3,(H2,10,12) |
| InChIKey | JLWIKCQINLNJIS-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.24 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |