C18H40N2Si — CID 154083998
1-N,1-N,1-N',1-N'-tetrapropyl-6-silylhex-5-ene-1,1-diamine (PubChem CID 154083998) has the molecular formula C18H40N2Si and a molecular weight of 312.62 g/mol. Its IUPAC name is 1-N,1-N,1-N',1-N'-tetrapropyl-6-silylhex-5-ene-1,1-diamine.
| Compound Name | 1-N,1-N,1-N',1-N'-tetrapropyl-6-silylhex-5-ene-1,1-diamine |
|---|---|
| PubChem CID | 154083998 |
| Molecular Formula | C18H40N2Si |
| Molecular Weight | 312.62 g/mol |
| Exact Mass | 312.30 |
| IUPAC Name | 1-N,1-N,1-N',1-N'-tetrapropyl-6-silylhex-5-ene-1,1-diamine |
| SMILES | CCCN(CCC)C(CCCC=C[SiH3])N(CCC)CCC |
| InChI | InChI=1S/C18H40N2Si/c1-5-13-19(14-6-2)18(12-10-9-11-17-21)20(15-7-3)16-8-4/h11,17-18H,5-10,12-16H2,1-4,21H3 |
| InChIKey | HDQRPJBFWBVCOJ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.62 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|