C18H23NO2 — CID 154087976
(1R,9R,10R)-3-methoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-17-carbaldehyde (PubChem CID 154087976) has the molecular formula C18H23NO2 and a molecular weight of 285.39 g/mol. Its IUPAC name is (1R,9R,10R)-3-methoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-17-carbaldehyde.
| Compound Name | (1R,9R,10R)-3-methoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-17-carbaldehyde |
|---|---|
| PubChem CID | 154087976 |
| Molecular Formula | C18H23NO2 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | (1R,9R,10R)-3-methoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-17-carbaldehyde |
| SMILES | COc1cccc2c1[C@@]13CCCC[C@H]1[C@@H](C2)N(C=O)CC3 |
| InChI | InChI=1S/C18H23NO2/c1-21-16-7-4-5-13-11-15-14-6-2-3-8-18(14,17(13)16)9-10-19(15)12-20/h4-5,7,12,14-15H,2-3,6,8-11H2,1H3/t14-,15+,18+/m0/s1 |
| InChIKey | HUPPMZAZDPCPDA-HDMKZQKVSA-N |
| XLogP | 2.91 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|