C23H25NO — CID 22810375
(1R,9R,10R)-4-phenyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-17-carbaldehyde (PubChem CID 22810375) has the molecular formula C23H25NO and a molecular weight of 331.46 g/mol. Its IUPAC name is (1R,9R,10R)-4-phenyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-17-carbaldehyde.
| Compound Name | (1R,9R,10R)-4-phenyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-17-carbaldehyde |
|---|---|
| PubChem CID | 22810375 |
| Molecular Formula | C23H25NO |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | (1R,9R,10R)-4-phenyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-17-carbaldehyde |
| SMILES | O=CN1CC[C@]23CCCC[C@H]2[C@H]1Cc1ccc(-c2ccccc2)cc13 |
| InChI | InChI=1S/C23H25NO/c25-16-24-13-12-23-11-5-4-8-20(23)22(24)15-19-10-9-18(14-21(19)23)17-6-2-1-3-7-17/h1-3,6-7,9-10,14,16,20,22H,4-5,8,11-13,15H2/t20-,22+,23+/m0/s1 |
| InChIKey | PBAIIHOHYLDCHW-MDNUFGMLSA-N |
| XLogP | 4.57 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|