C20H24N2S — CID 122501833
3-[(1S,9S)-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]-1,2-thiazole (PubChem CID 122501833) has the molecular formula C20H24N2S and a molecular weight of 324.49 g/mol. Its IUPAC name is 3-[(1S,9S)-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]-1,2-thiazole.
| Compound Name | 3-[(1S,9S)-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]-1,2-thiazole |
|---|---|
| PubChem CID | 122501833 |
| Molecular Formula | C20H24N2S |
| Molecular Weight | 324.49 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | 3-[(1S,9S)-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]-1,2-thiazole |
| SMILES | CN1CC[C@@]23CCCCC2[C@@H]1Cc1ccc(-c2ccsn2)cc13 |
| InChI | InChI=1S/C20H24N2S/c1-22-10-9-20-8-3-2-4-16(20)19(22)13-14-5-6-15(12-17(14)20)18-7-11-23-21-18/h5-7,11-12,16,19H,2-4,8-10,13H2,1H3/t16?,19-,20-/m0/s1 |
| InChIKey | OBDWFCSWEMOCRB-RFFXKOPCSA-N |
| XLogP | 4.50 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.49 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |