C25H37NO6 — CID 15409038
tert-butyl (2S)-2-[(3aR,7R,7aR)-2,2-dimethyl-4-oxo-7-phenylmethoxy-3a,6,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyridin-5-yl]-4-methylpentanoate (PubChem CID 15409038) has the molecular formula C25H37NO6 and a molecular weight of 447.57 g/mol. Its IUPAC name is tert-butyl (2S)-2-[(3aR,7R,7aR)-2,2-dimethyl-4-oxo-7-phenylmethoxy-3a,6,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyridin-5-yl]-4-methylpentanoate.
| Compound Name | tert-butyl (2S)-2-[(3aR,7R,7aR)-2,2-dimethyl-4-oxo-7-phenylmethoxy-3a,6,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyridin-5-yl]-4-methylpentanoate |
|---|---|
| PubChem CID | 15409038 |
| Molecular Formula | C25H37NO6 |
| Molecular Weight | 447.57 g/mol |
| Exact Mass | 447.26 |
| IUPAC Name | tert-butyl (2S)-2-[(3aR,7R,7aR)-2,2-dimethyl-4-oxo-7-phenylmethoxy-3a,6,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyridin-5-yl]-4-methylpentanoate |
| SMILES | CC(C)C[C@@H](C(=O)OC(C)(C)C)N1C[C@@H](OCc2ccccc2)[C@H]2OC(C)(C)O[C@H]2C1=O |
| InChI | InChI=1S/C25H37NO6/c1-16(2)13-18(23(28)32-24(3,4)5)26-14-19(29-15-17-11-9-8-10-12-17)20-21(22(26)27)31-25(6,7)30-20/h8-12,16,18-21H,13-15H2,1-7H3/t18-,19+,20+,21+/m0/s1 |
| InChIKey | YGDMJQMEFDWEDQ-DOIPELPJSA-N |
| XLogP | 3.69 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.57 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |