C14H17Cl4NO2 — CID 154099049
2,2-dichloro-N-[(3,4-dichlorophenyl)methyl]-N-(3-ethoxypropyl)acetamide (PubChem CID 154099049) has the molecular formula C14H17Cl4NO2 and a molecular weight of 373.11 g/mol. Its IUPAC name is 2,2-dichloro-N-[(3,4-dichlorophenyl)methyl]-N-(3-ethoxypropyl)acetamide.
| Compound Name | 2,2-dichloro-N-[(3,4-dichlorophenyl)methyl]-N-(3-ethoxypropyl)acetamide |
|---|---|
| PubChem CID | 154099049 |
| Molecular Formula | C14H17Cl4NO2 |
| Molecular Weight | 373.11 g/mol |
| Exact Mass | 371.00 |
| IUPAC Name | 2,2-dichloro-N-[(3,4-dichlorophenyl)methyl]-N-(3-ethoxypropyl)acetamide |
| SMILES | CCOCCCN(Cc1ccc(Cl)c(Cl)c1)C(=O)C(Cl)Cl |
| InChI | InChI=1S/C14H17Cl4NO2/c1-2-21-7-3-6-19(14(20)13(17)18)9-10-4-5-11(15)12(16)8-10/h4-5,8,13H,2-3,6-7,9H2,1H3 |
| InChIKey | NMMOCZWLAHBPPG-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.11 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|