C9H16N2O3 — CID 154099655
1,1-bis(2-ethenoxyethyl)urea (PubChem CID 154099655) has the molecular formula C9H16N2O3 and a molecular weight of 200.24 g/mol. Its IUPAC name is 1,1-bis(2-ethenoxyethyl)urea.
| Compound Name | 1,1-bis(2-ethenoxyethyl)urea |
|---|---|
| PubChem CID | 154099655 |
| Molecular Formula | C9H16N2O3 |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.12 |
| IUPAC Name | 1,1-bis(2-ethenoxyethyl)urea |
| SMILES | C=COCCN(CCOC=C)C(N)=O |
| InChI | InChI=1S/C9H16N2O3/c1-3-13-7-5-11(9(10)12)6-8-14-4-2/h3-4H,1-2,5-8H2,(H2,10,12) |
| InChIKey | YQYRLBBLSBXFHF-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|