C8H14N2O4 — CID 139748452
2-[carbamoyl(hydroxymethyl)amino]ethyl 2-methylprop-2-enoate (PubChem CID 139748452) has the molecular formula C8H14N2O4 and a molecular weight of 202.21 g/mol. Its IUPAC name is 2-[carbamoyl(hydroxymethyl)amino]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[carbamoyl(hydroxymethyl)amino]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 139748452 |
| Molecular Formula | C8H14N2O4 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | 2-[carbamoyl(hydroxymethyl)amino]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCN(CO)C(N)=O |
| InChI | InChI=1S/C8H14N2O4/c1-6(2)7(12)14-4-3-10(5-11)8(9)13/h11H,1,3-5H2,2H3,(H2,9,13) |
| InChIKey | HBOTYVBQGCOQHF-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 92.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|