C16H10N2O4S — CID 154100458
4-oxo-7H-benzo[a]phenazine-2-sulfonic acid (PubChem CID 154100458) has the molecular formula C16H10N2O4S and a molecular weight of 326.33 g/mol. Its IUPAC name is 4-oxo-7H-benzo[a]phenazine-2-sulfonic acid.
| Compound Name | 4-oxo-7H-benzo[a]phenazine-2-sulfonic acid |
|---|---|
| PubChem CID | 154100458 |
| Molecular Formula | C16H10N2O4S |
| Molecular Weight | 326.33 g/mol |
| Exact Mass | 326.04 |
| IUPAC Name | 4-oxo-7H-benzo[a]phenazine-2-sulfonic acid |
| SMILES | O=c1cc(S(=O)(=O)O)cc2c1ccc1[nH]c3ccccc3nc12 |
| InChI | InChI=1S/C16H10N2O4S/c19-15-8-9(23(20,21)22)7-11-10(15)5-6-14-16(11)18-13-4-2-1-3-12(13)17-14/h1-8,17H,(H,20,21,22) |
| InChIKey | MGXQSMZHFBJNIM-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 100.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.33 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_6666_A(2)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|