C64H32N14 — CID 88944189
CID 88944189 (PubChem CID 88944189) has the molecular formula C64H32N14 and a molecular weight of 997.06 g/mol.
| Compound Name | CID 88944189 |
|---|---|
| PubChem CID | 88944189 |
| Molecular Formula | C64H32N14 |
| Molecular Weight | 997.06 g/mol |
| Exact Mass | 996.29 |
| IUPAC Name | — |
| SMILES | c1cc2ccc3nc2c2nc(ccc12)c1ccc([nH]1)c1ccc2c(n1)c1nc(ccc1c1nc4c5ccc6nc5c5nc(ccc5c4nc21)c1ccc([nH]1)c1ccc2ccc4ccc(nc4c2n1)c1ccc6[nH]1)c1ccc3[nH]1 |
| InChI | InChI=1S/C64H32N14/c1-2-30-6-14-46-38-22-26-42(66-38)50-18-10-34-58(74-50)57-33(9-17-49(73-57)41-25-21-37(65-41)45-13-5-29(1)53(69-45)54(30)70-46)61-62(34)78-64-36-12-20-52-44-28-24-40(68-44)48-16-8-32-4-3-31-7-15-47(71-55(31)56(32)72-48)39-23-27-43(67-39)51-19-11-35(63(64)77-61)59(75-51)60(36)76-52/h1-28,65-68H/b45-37-,46-38-,47-39-,48-40-,49-41-,50-42-,51-43-,52-44- |
| InChIKey | GKIJGXLVLYWGFE-SGIPSKHASA-N |
| XLogP | 14.83 |
| TPSA | 192.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | |
| Heavy Atoms | 78 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 997.06 |
| LogP ≤ 5 | 14.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|