C14H14N2OS2 — CID 154100729
2-butoxy-4-(4-isothiocyanatophenyl)-1,3-thiazole (PubChem CID 154100729) has the molecular formula C14H14N2OS2 and a molecular weight of 290.41 g/mol. Its IUPAC name is 2-butoxy-4-(4-isothiocyanatophenyl)-1,3-thiazole.
| Compound Name | 2-butoxy-4-(4-isothiocyanatophenyl)-1,3-thiazole |
|---|---|
| PubChem CID | 154100729 |
| Molecular Formula | C14H14N2OS2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.05 |
| IUPAC Name | 2-butoxy-4-(4-isothiocyanatophenyl)-1,3-thiazole |
| SMILES | CCCCOc1nc(-c2ccc(N=C=S)cc2)cs1 |
| InChI | InChI=1S/C14H14N2OS2/c1-2-3-8-17-14-16-13(9-19-14)11-4-6-12(7-5-11)15-10-18/h4-7,9H,2-3,8H2,1H3 |
| InChIKey | JXPKXWVCGMWKBS-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 34.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|