C11H15N5O4S — CID 154105914
4-amino-N-(4,6-dimethoxy-1H-triazin-2-yl)benzenesulfonamide (PubChem CID 154105914) has the molecular formula C11H15N5O4S and a molecular weight of 313.34 g/mol. Its IUPAC name is 4-amino-N-(4,6-dimethoxy-1H-triazin-2-yl)benzenesulfonamide.
| Compound Name | 4-amino-N-(4,6-dimethoxy-1H-triazin-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 154105914 |
| Molecular Formula | C11H15N5O4S |
| Molecular Weight | 313.34 g/mol |
| Exact Mass | 313.08 |
| IUPAC Name | 4-amino-N-(4,6-dimethoxy-1H-triazin-2-yl)benzenesulfonamide |
| SMILES | COC1=CC(OC)=NN(NS(=O)(=O)c2ccc(N)cc2)N1 |
| InChI | InChI=1S/C11H15N5O4S/c1-19-10-7-11(20-2)14-16(13-10)15-21(17,18)9-5-3-8(12)4-6-9/h3-7,13,15H,12H2,1-2H3 |
| InChIKey | CUWVPJFXIGOWPA-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 118.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.34 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|