C15H21F3N2 — CID 15410600
N-methyl-N-[(E)-[4-methyl-1-[4-(trifluoromethyl)phenyl]pentan-3-ylidene]amino]methanamine (PubChem CID 15410600) has the molecular formula C15H21F3N2 and a molecular weight of 286.34 g/mol. Its IUPAC name is N-methyl-N-[(E)-[4-methyl-1-[4-(trifluoromethyl)phenyl]pentan-3-ylidene]amino]methanamine.
| Compound Name | N-methyl-N-[(E)-[4-methyl-1-[4-(trifluoromethyl)phenyl]pentan-3-ylidene]amino]methanamine |
|---|---|
| PubChem CID | 15410600 |
| Molecular Formula | C15H21F3N2 |
| Molecular Weight | 286.34 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | N-methyl-N-[(E)-[4-methyl-1-[4-(trifluoromethyl)phenyl]pentan-3-ylidene]amino]methanamine |
| SMILES | CC(C)/C(CCc1ccc(C(F)(F)F)cc1)=N/N(C)C |
| InChI | InChI=1S/C15H21F3N2/c1-11(2)14(19-20(3)4)10-7-12-5-8-13(9-6-12)15(16,17)18/h5-6,8-9,11H,7,10H2,1-4H3/b19-14+ |
| InChIKey | GRJVCMJMUUYVCV-XMHGGMMESA-N |
| XLogP | 4.21 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.34 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|